C16H21FN6O — CID 111091252
4-(4-fluorophenyl)-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111091252) has the molecular formula C16H21FN6O and a molecular weight of 332.38 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-fluorophenyl)-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111091252 |
| Molecular Formula | C16H21FN6O |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | Cc1noc(CC/N=C(\N)N2CCN(c3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C16H21FN6O/c1-12-20-15(24-21-12)6-7-19-16(18)23-10-8-22(9-11-23)14-4-2-13(17)3-5-14/h2-5H,6-11H2,1H3,(H2,18,19) |
| InChIKey | CXPIUEFCHOCVML-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|