C16H24FIN4 — CID 111813721
4-(4-fluorophenyl)-N'-pent-3-enylpiperazine-1-carboximidamide;hydroiodide (PubChem CID 111813721) has the molecular formula C16H24FIN4 and a molecular weight of 418.30 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N'-pent-3-enylpiperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-fluorophenyl)-N'-pent-3-enylpiperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111813721 |
| Molecular Formula | C16H24FIN4 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 4-(4-fluorophenyl)-N'-pent-3-enylpiperazine-1-carboximidamide;hydroiodide |
| SMILES | CC=CCC/N=C(\N)N1CCN(c2ccc(F)cc2)CC1.I |
| InChI | InChI=1S/C16H23FN4.HI/c1-2-3-4-9-19-16(18)21-12-10-20(11-13-21)15-7-5-14(17)6-8-15;/h2-3,5-8H,4,9-13H2,1H3,(H2,18,19);1H |
| InChIKey | LJTBQASGCXPXNM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|