C20H22ClN7 — CID 111066058
4-(4-chlorophenyl)-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111066058) has the molecular formula C20H22ClN7 and a molecular weight of 395.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(4-chlorophenyl)-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111066058 |
| Molecular Formula | C20H22ClN7 |
| Molecular Weight | 395.90 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1nncn1-c1ccccc1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H22ClN7/c21-16-6-8-17(9-7-16)26-10-12-27(13-11-26)20(22)23-14-19-25-24-15-28(19)18-4-2-1-3-5-18/h1-9,15H,10-14H2,(H2,22,23) |
| InChIKey | CBZLXJYWLSCJTB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.90 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|