C19H28IN7O2 — CID 111066049
tert-butyl 4-[N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111066049) has the molecular formula C19H28IN7O2 and a molecular weight of 513.38 g/mol. Its IUPAC name is tert-butyl 4-[N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111066049 |
| Molecular Formula | C19H28IN7O2 |
| Molecular Weight | 513.38 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | tert-butyl 4-[N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C(N)=N/Cc2nncn2-c2ccccc2)CC1.I |
| InChI | InChI=1S/C19H27N7O2.HI/c1-19(2,3)28-18(27)25-11-9-24(10-12-25)17(20)21-13-16-23-22-14-26(16)15-7-5-4-6-8-15;/h4-8,14H,9-13H2,1-3H3,(H2,20,21);1H |
| InChIKey | NOTGSJCUQIUHOR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 101.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|