C14H18N6S — CID 111066056
N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 111066056) has the molecular formula C14H18N6S and a molecular weight of 302.41 g/mol. Its IUPAC name is N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111066056 |
| Molecular Formula | C14H18N6S |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N'-[(4-phenyl-1,2,4-triazol-3-yl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | N/C(=N\Cc1nncn1-c1ccccc1)N1CCSCC1 |
| InChI | InChI=1S/C14H18N6S/c15-14(19-6-8-21-9-7-19)16-10-13-18-17-11-20(13)12-4-2-1-3-5-12/h1-5,11H,6-10H2,(H2,15,16) |
| InChIKey | JSAQCDMVTZAFOH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|