C16H22IN5S — CID 119117813
N'-[[2-(imidazol-1-ylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 119117813) has the molecular formula C16H22IN5S and a molecular weight of 443.36 g/mol. Its IUPAC name is N'-[[2-(imidazol-1-ylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[2-(imidazol-1-ylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119117813 |
| Molecular Formula | C16H22IN5S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | N'-[[2-(imidazol-1-ylmethyl)phenyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccccc1Cn1ccnc1)N1CCSCC1 |
| InChI | InChI=1S/C16H21N5S.HI/c17-16(21-7-9-22-10-8-21)19-11-14-3-1-2-4-15(14)12-20-6-5-18-13-20;/h1-6,13H,7-12H2,(H2,17,19);1H |
| InChIKey | NYAWQVOFSMVWOZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|