C19H24IN7S — CID 111051563
N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111051563) has the molecular formula C19H24IN7S and a molecular weight of 509.42 g/mol. Its IUPAC name is N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111051563 |
| Molecular Formula | C19H24IN7S |
| Molecular Weight | 509.42 g/mol |
| Exact Mass | 509.09 |
| IUPAC Name | N'-[[3-(imidazol-1-ylmethyl)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(Cn2ccnc2)c1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C19H23N7S.HI/c20-18(25-7-9-26(10-8-25)19-22-5-11-27-19)23-13-16-2-1-3-17(12-16)14-24-6-4-21-15-24;/h1-6,11-12,15H,7-10,13-14H2,(H2,20,23);1H |
| InChIKey | ADVMQHPYMAWUHI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|