C16H19F2N5OS — CID 111093343
N'-[[3-(difluoromethoxy)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111093343) has the molecular formula C16H19F2N5OS and a molecular weight of 367.43 g/mol. Its IUPAC name is N'-[[3-(difluoromethoxy)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[[3-(difluoromethoxy)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111093343 |
| Molecular Formula | C16H19F2N5OS |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N'-[[3-(difluoromethoxy)phenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\Cc1cccc(OC(F)F)c1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C16H19F2N5OS/c17-14(18)24-13-3-1-2-12(10-13)11-21-15(19)22-5-7-23(8-6-22)16-20-4-9-25-16/h1-4,9-10,14H,5-8,11H2,(H2,19,21) |
| InChIKey | XOGZSLRGCRQDTJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 66.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|