C18H24F2IN5O2S — CID 111051871
N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide (PubChem CID 111051871) has the molecular formula C18H24F2IN5O2S and a molecular weight of 539.39 g/mol. Its IUPAC name is N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide.
| Compound Name | N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111051871 |
| Molecular Formula | C18H24F2IN5O2S |
| Molecular Weight | 539.39 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | N'-[[4-(difluoromethoxy)-3-ethoxyphenyl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide;hydroiodide |
| SMILES | CCOc1cc(C/N=C(\N)N2CCN(c3nccs3)CC2)ccc1OC(F)F.I |
| InChI | InChI=1S/C18H23F2N5O2S.HI/c1-2-26-15-11-13(3-4-14(15)27-16(19)20)12-23-17(21)24-6-8-25(9-7-24)18-22-5-10-28-18;/h3-5,10-11,16H,2,6-9,12H2,1H3,(H2,21,23);1H |
| InChIKey | HOLDFWHPTUUEGQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|