C22H32IN7OS — CID 111803846
1-[[3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide (PubChem CID 111803846) has the molecular formula C22H32IN7OS and a molecular weight of 569.52 g/mol. Its IUPAC name is 1-[[3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide.
| Compound Name | 1-[[3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111803846 |
| Molecular Formula | C22H32IN7OS |
| Molecular Weight | 569.52 g/mol |
| Exact Mass | 569.14 |
| IUPAC Name | 1-[[3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]phenyl]methyl]piperidine-3-carboxamide;hydroiodide |
| SMILES | I.NC(=O)C1CCCN(Cc2cccc(C/N=C(\N)N3CCN(c4nccs4)CC3)c2)C1 |
| InChI | InChI=1S/C22H31N7OS.HI/c23-20(30)19-5-2-7-27(16-19)15-18-4-1-3-17(13-18)14-26-21(24)28-8-10-29(11-9-28)22-25-6-12-31-22;/h1,3-4,6,12-13,19H,2,5,7-11,14-16H2,(H2,23,30)(H2,24,26);1H |
| InChIKey | PAVUMHFCBLCJNK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.52 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|