C11H20N6S — CID 111822214
N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]thiomorpholine-4-carboximidamide (PubChem CID 111822214) has the molecular formula C11H20N6S and a molecular weight of 268.39 g/mol. Its IUPAC name is N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111822214 |
| Molecular Formula | C11H20N6S |
| Molecular Weight | 268.39 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]thiomorpholine-4-carboximidamide |
| SMILES | CCc1nncn1CC/N=C(\N)N1CCSCC1 |
| InChI | InChI=1S/C11H20N6S/c1-2-10-15-14-9-17(10)4-3-13-11(12)16-5-7-18-8-6-16/h9H,2-8H2,1H3,(H2,12,13) |
| InChIKey | SCJWULCZGCJIIB-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.39 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|