C13H23N5S — CID 111817882
N'-[4-(2-methylimidazol-1-yl)butyl]thiomorpholine-4-carboximidamide (PubChem CID 111817882) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is N'-[4-(2-methylimidazol-1-yl)butyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[4-(2-methylimidazol-1-yl)butyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111817882 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | N'-[4-(2-methylimidazol-1-yl)butyl]thiomorpholine-4-carboximidamide |
| SMILES | Cc1nccn1CCCC/N=C(\N)N1CCSCC1 |
| InChI | InChI=1S/C13H23N5S/c1-12-15-5-7-17(12)6-3-2-4-16-13(14)18-8-10-19-11-9-18/h5,7H,2-4,6,8-11H2,1H3,(H2,14,16) |
| InChIKey | PUHUHMVMRQDIKL-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 59.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|