C15H21IN6S — CID 111052850
N'-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide (PubChem CID 111052850) has the molecular formula C15H21IN6S and a molecular weight of 444.35 g/mol. Its IUPAC name is N'-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111052850 |
| Molecular Formula | C15H21IN6S |
| Molecular Weight | 444.35 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | N'-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]thiomorpholine-4-carboximidamide;hydroiodide |
| SMILES | Cc1nccn1-c1ccc(C/N=C(\N)N2CCSCC2)cn1.I |
| InChI | InChI=1S/C15H20N6S.HI/c1-12-17-4-5-21(12)14-3-2-13(10-18-14)11-19-15(16)20-6-8-22-9-7-20;/h2-5,10H,6-9,11H2,1H3,(H2,16,19);1H |
| InChIKey | YEQWWGLHFGZUKC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.35 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|