C16H22N6 — CID 110987854
1-cyclopropyl-3-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine (PubChem CID 110987854) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1-cyclopropyl-3-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine.
| Compound Name | 1-cyclopropyl-3-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine |
|---|---|
| PubChem CID | 110987854 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-cyclopropyl-3-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)nc1)NC1CC1 |
| InChI | InChI=1S/C16H22N6/c1-3-17-16(21-14-5-6-14)20-11-13-4-7-15(19-10-13)22-9-8-18-12(22)2/h4,7-10,14H,3,5-6,11H2,1-2H3,(H2,17,20,21) |
| InChIKey | RVDDHGHXLPDFDX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|