C16H22F3IN6 — CID 109471642
1-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide (PubChem CID 109471642) has the molecular formula C16H22F3IN6 and a molecular weight of 482.29 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 109471642 |
| Molecular Formula | C16H22F3IN6 |
| Molecular Weight | 482.29 g/mol |
| Exact Mass | 482.09 |
| IUPAC Name | 1-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]-3-(3,3,3-trifluoropropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)nc1)NCCC(F)(F)F.I |
| InChI | InChI=1S/C16H21F3N6.HI/c1-3-20-15(22-7-6-16(17,18)19)24-11-13-4-5-14(23-10-13)25-9-8-21-12(25)2;/h4-5,8-10H,3,6-7,11H2,1-2H3,(H2,20,22,24);1H |
| InChIKey | LHYDKCGJNVGRFR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|