C22H35IN6O — CID 111398284
1-(3-cyclohexyloxypropyl)-3-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111398284) has the molecular formula C22H35IN6O and a molecular weight of 526.47 g/mol. Its IUPAC name is 1-(3-cyclohexyloxypropyl)-3-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-cyclohexyloxypropyl)-3-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111398284 |
| Molecular Formula | C22H35IN6O |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | 1-(3-cyclohexyloxypropyl)-3-ethyl-2-[[6-(2-methylimidazol-1-yl)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-n2ccnc2C)nc1)NCCCOC1CCCCC1.I |
| InChI | InChI=1S/C22H34N6O.HI/c1-3-23-22(25-12-7-15-29-20-8-5-4-6-9-20)27-17-19-10-11-21(26-16-19)28-14-13-24-18(28)2;/h10-11,13-14,16,20H,3-9,12,15,17H2,1-2H3,(H2,23,25,27);1H |
| InChIKey | WPUARWGVWZYONY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|