C14H22N4OS — CID 111804494
N'-[(6-propoxy-3-pyridinyl)methyl]thiomorpholine-4-carboximidamide (PubChem CID 111804494) has the molecular formula C14H22N4OS and a molecular weight of 294.42 g/mol. Its IUPAC name is N'-[(6-propoxy-3-pyridinyl)methyl]thiomorpholine-4-carboximidamide.
| Compound Name | N'-[(6-propoxy-3-pyridinyl)methyl]thiomorpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111804494 |
| Molecular Formula | C14H22N4OS |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N'-[(6-propoxy-3-pyridinyl)methyl]thiomorpholine-4-carboximidamide |
| SMILES | CCCOc1ccc(C/N=C(\N)N2CCSCC2)cn1 |
| InChI | InChI=1S/C14H22N4OS/c1-2-7-19-13-4-3-12(10-16-13)11-17-14(15)18-5-8-20-9-6-18/h3-4,10H,2,5-9,11H2,1H3,(H2,15,17) |
| InChIKey | FASJTMBVJIYOMR-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|