C20H23ClIN7 — CID 119147445
4-(4-chlorophenyl)-N'-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 119147445) has the molecular formula C20H23ClIN7 and a molecular weight of 523.81 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N'-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(4-chlorophenyl)-N'-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119147445 |
| Molecular Formula | C20H23ClIN7 |
| Molecular Weight | 523.81 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | 4-(4-chlorophenyl)-N'-[[3-(1,2,4-triazol-1-yl)phenyl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(-n2cncn2)c1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C20H22ClN7.HI/c21-17-4-6-18(7-5-17)26-8-10-27(11-9-26)20(22)24-13-16-2-1-3-19(12-16)28-15-23-14-25-28;/h1-7,12,14-15H,8-11,13H2,(H2,22,24);1H |
| InChIKey | SAUITOCHFHIWPD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 75.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.81 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|