C10H18IN5O — CID 119147857
1-cyclopentyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 119147857) has the molecular formula C10H18IN5O and a molecular weight of 351.19 g/mol. Its IUPAC name is 1-cyclopentyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119147857 |
| Molecular Formula | C10H18IN5O |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 1-cyclopentyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | Cc1nc(C/N=C(\N)NC2CCCC2)no1.I |
| InChI | InChI=1S/C10H17N5O.HI/c1-7-13-9(15-16-7)6-12-10(11)14-8-4-2-3-5-8;/h8H,2-6H2,1H3,(H3,11,12,14);1H |
| InChIKey | DGEZLTDJXIGCCE-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 89.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|