C9H18IN5O — CID 111465113
1,3-diethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111465113) has the molecular formula C9H18IN5O and a molecular weight of 339.18 g/mol. Its IUPAC name is 1,3-diethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1,3-diethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111465113 |
| Molecular Formula | C9H18IN5O |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1,3-diethyl-2-[(5-methyl-1,2,4-oxadiazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCNC(=NCc1noc(C)n1)NCC.I |
| InChI | InChI=1S/C9H17N5O.HI/c1-4-10-9(11-5-2)12-6-8-13-7(3)15-14-8;/h4-6H2,1-3H3,(H2,10,11,12);1H |
| InChIKey | IOOIGLGXAKTEHX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|