C15H21ClN6O — CID 120762645
2-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-1-(3-chloro-4-methoxyphenyl)guanidine (PubChem CID 120762645) has the molecular formula C15H21ClN6O and a molecular weight of 336.83 g/mol. Its IUPAC name is 2-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-1-(3-chloro-4-methoxyphenyl)guanidine.
| Compound Name | 2-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-1-(3-chloro-4-methoxyphenyl)guanidine |
|---|---|
| PubChem CID | 120762645 |
| Molecular Formula | C15H21ClN6O |
| Molecular Weight | 336.83 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-[(2-tert-butyl-1,2,4-triazol-3-yl)methyl]-1-(3-chloro-4-methoxyphenyl)guanidine |
| SMILES | COc1ccc(N/C(N)=N/Cc2ncnn2C(C)(C)C)cc1Cl |
| InChI | InChI=1S/C15H21ClN6O/c1-15(2,3)22-13(19-9-20-22)8-18-14(17)21-10-5-6-12(23-4)11(16)7-10/h5-7,9H,8H2,1-4H3,(H3,17,18,21) |
| InChIKey | HNWLKNOGLWZLMF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|