C17H18ClIN6O — CID 111071830
1-(3-chloro-4-methoxyphenyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111071830) has the molecular formula C17H18ClIN6O and a molecular weight of 484.73 g/mol. Its IUPAC name is 1-(3-chloro-4-methoxyphenyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-chloro-4-methoxyphenyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111071830 |
| Molecular Formula | C17H18ClIN6O |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | 1-(3-chloro-4-methoxyphenyl)-2-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc(-n3cncn3)cc2)cc1Cl.I |
| InChI | InChI=1S/C17H17ClN6O.HI/c1-25-16-7-4-13(8-15(16)18)23-17(19)21-9-12-2-5-14(6-3-12)24-11-20-10-22-24;/h2-8,10-11H,9H2,1H3,(H3,19,21,23);1H |
| InChIKey | NNCVKTYJQPETSP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|