C18H30ClN3 — CID 14853437
2-[(4-tert-butylphenyl)methyl]-1-cyclohexylguanidine;hydrochloride (PubChem CID 14853437) has the molecular formula C18H30ClN3 and a molecular weight of 323.91 g/mol. Its IUPAC name is 2-[(4-tert-butylphenyl)methyl]-1-cyclohexylguanidine;hydrochloride.
| Compound Name | 2-[(4-tert-butylphenyl)methyl]-1-cyclohexylguanidine;hydrochloride |
|---|---|
| PubChem CID | 14853437 |
| Molecular Formula | C18H30ClN3 |
| Molecular Weight | 323.91 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-[(4-tert-butylphenyl)methyl]-1-cyclohexylguanidine;hydrochloride |
| SMILES | CC(C)(C)c1ccc(C/N=C(\N)NC2CCCCC2)cc1.Cl |
| InChI | InChI=1S/C18H29N3.ClH/c1-18(2,3)15-11-9-14(10-12-15)13-20-17(19)21-16-7-5-4-6-8-16;/h9-12,16H,4-8,13H2,1-3H3,(H3,19,20,21);1H |
| InChIKey | JSULVWDOCKHKAS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.91 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|