C17H27IN4O2S — CID 111072198
1-cyclohexyl-2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111072198) has the molecular formula C17H27IN4O2S and a molecular weight of 478.40 g/mol. Its IUPAC name is 1-cyclohexyl-2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111072198 |
| Molecular Formula | C17H27IN4O2S |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 1-cyclohexyl-2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccc(S(=O)(=O)NC2CC2)cc1)NC1CCCCC1 |
| InChI | InChI=1S/C17H26N4O2S.HI/c18-17(20-14-4-2-1-3-5-14)19-12-13-6-10-16(11-7-13)24(22,23)21-15-8-9-15;/h6-7,10-11,14-15,21H,1-5,8-9,12H2,(H3,18,19,20);1H |
| InChIKey | OMJBVELONACYHQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|