C15H23IN4O2S — CID 111072244
2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide (PubChem CID 111072244) has the molecular formula C15H23IN4O2S and a molecular weight of 450.35 g/mol. Its IUPAC name is 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide.
| Compound Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111072244 |
| Molecular Formula | C15H23IN4O2S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 2-[[4-(cyclopropylsulfamoyl)phenyl]methyl]-1-(2-methylprop-2-enyl)guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(N)=N/Cc1ccc(S(=O)(=O)NC2CC2)cc1.I |
| InChI | InChI=1S/C15H22N4O2S.HI/c1-11(2)9-17-15(16)18-10-12-3-7-14(8-4-12)22(20,21)19-13-5-6-13;/h3-4,7-8,13,19H,1,5-6,9-10H2,2H3,(H3,16,17,18);1H |
| InChIKey | WVTRBQRPOVAGMW-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|