C19H23FN4O2S — CID 119164154
1-cyclopentyl-2-[[4-[(4-fluorophenyl)sulfamoyl]phenyl]methyl]guanidine (PubChem CID 119164154) has the molecular formula C19H23FN4O2S and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-cyclopentyl-2-[[4-[(4-fluorophenyl)sulfamoyl]phenyl]methyl]guanidine.
| Compound Name | 1-cyclopentyl-2-[[4-[(4-fluorophenyl)sulfamoyl]phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 119164154 |
| Molecular Formula | C19H23FN4O2S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 1-cyclopentyl-2-[[4-[(4-fluorophenyl)sulfamoyl]phenyl]methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(S(=O)(=O)Nc2ccc(F)cc2)cc1)NC1CCCC1 |
| InChI | InChI=1S/C19H23FN4O2S/c20-15-7-9-17(10-8-15)24-27(25,26)18-11-5-14(6-12-18)13-22-19(21)23-16-3-1-2-4-16/h5-12,16,24H,1-4,13H2,(H3,21,22,23) |
| InChIKey | VYJYGQWKQXLLKE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|