C16H27IN4O2S — CID 111043745
1-cyclohexyl-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide (PubChem CID 111043745) has the molecular formula C16H27IN4O2S and a molecular weight of 466.39 g/mol. Its IUPAC name is 1-cyclohexyl-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-cyclohexyl-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111043745 |
| Molecular Formula | C16H27IN4O2S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 466.09 |
| IUPAC Name | 1-cyclohexyl-2-[2-[(4-methylphenyl)sulfonylamino]ethyl]guanidine;hydroiodide |
| SMILES | Cc1ccc(S(=O)(=O)NCC/N=C(\N)NC2CCCCC2)cc1.I |
| InChI | InChI=1S/C16H26N4O2S.HI/c1-13-7-9-15(10-8-13)23(21,22)19-12-11-18-16(17)20-14-5-3-2-4-6-14;/h7-10,14,19H,2-6,11-12H2,1H3,(H3,17,18,20);1H |
| InChIKey | PFOPDMFNJKFTQA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|