C12H20N4O2S2 — CID 119954337
1-cyclopentyl-2-[2-(thiophen-2-ylsulfonylamino)ethyl]guanidine (PubChem CID 119954337) has the molecular formula C12H20N4O2S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 1-cyclopentyl-2-[2-(thiophen-2-ylsulfonylamino)ethyl]guanidine.
| Compound Name | 1-cyclopentyl-2-[2-(thiophen-2-ylsulfonylamino)ethyl]guanidine |
|---|---|
| PubChem CID | 119954337 |
| Molecular Formula | C12H20N4O2S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-cyclopentyl-2-[2-(thiophen-2-ylsulfonylamino)ethyl]guanidine |
| SMILES | N/C(=N\CCNS(=O)(=O)c1cccs1)NC1CCCC1 |
| InChI | InChI=1S/C12H20N4O2S2/c13-12(16-10-4-1-2-5-10)14-7-8-15-20(17,18)11-6-3-9-19-11/h3,6,9-10,15H,1-2,4-5,7-8H2,(H3,13,14,16) |
| InChIKey | PAWZDGKOHNYJEL-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|