C13H20N2O3S2 — CID 114550202
N-(3-methylcyclopentyl)-3-(thiophen-2-ylsulfonylamino)propanamide (PubChem CID 114550202) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is N-(3-methylcyclopentyl)-3-(thiophen-2-ylsulfonylamino)propanamide.
| Compound Name | N-(3-methylcyclopentyl)-3-(thiophen-2-ylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 114550202 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | N-(3-methylcyclopentyl)-3-(thiophen-2-ylsulfonylamino)propanamide |
| SMILES | CC1CCC(NC(=O)CCNS(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C13H20N2O3S2/c1-10-4-5-11(9-10)15-12(16)6-7-14-20(17,18)13-3-2-8-19-13/h2-3,8,10-11,14H,4-7,9H2,1H3,(H,15,16) |
| InChIKey | UNLOLKAOOBUMCK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |