C11H22N2O3S — CID 94800013
3-(methanesulfonamido)-N-[(1S,3R)-3-methylcyclohexyl]propanamide (PubChem CID 94800013) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 3-(methanesulfonamido)-N-[(1S,3R)-3-methylcyclohexyl]propanamide.
| Compound Name | 3-(methanesulfonamido)-N-[(1S,3R)-3-methylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 94800013 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 3-(methanesulfonamido)-N-[(1S,3R)-3-methylcyclohexyl]propanamide |
| SMILES | C[C@@H]1CCC[C@H](NC(=O)CCNS(C)(=O)=O)C1 |
| InChI | InChI=1S/C11H22N2O3S/c1-9-4-3-5-10(8-9)13-11(14)6-7-12-17(2,15)16/h9-10,12H,3-8H2,1-2H3,(H,13,14)/t9-,10+/m1/s1 |
| InChIKey | FDCHFRZKXSEXHG-ZJUUUORDSA-N |
| XLogP | 0.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |