C10H19ClN2O — CID 131076439
1-(2-chloroethyl)-3-[(1R,3R)-3-methylcyclohexyl]urea (PubChem CID 131076439) has the molecular formula C10H19ClN2O and a molecular weight of 218.73 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[(1R,3R)-3-methylcyclohexyl]urea.
| Compound Name | 1-(2-chloroethyl)-3-[(1R,3R)-3-methylcyclohexyl]urea |
|---|---|
| PubChem CID | 131076439 |
| Molecular Formula | C10H19ClN2O |
| Molecular Weight | 218.73 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 1-(2-chloroethyl)-3-[(1R,3R)-3-methylcyclohexyl]urea |
| SMILES | C[C@@H]1CCC[C@@H](NC(=O)NCCCl)C1 |
| InChI | InChI=1S/C10H19ClN2O/c1-8-3-2-4-9(7-8)13-10(14)12-6-5-11/h8-9H,2-7H2,1H3,(H2,12,13,14)/t8-,9-/m1/s1 |
| InChIKey | ZEXAHTHOEXBQHM-RKDXNWHRSA-N |
| XLogP | 2.10 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.73 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|