C10H15NO4S2 — CID 110370165
N-[2-(1,3-dioxan-2-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110370165) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is N-[2-(1,3-dioxan-2-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(1,3-dioxan-2-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110370165 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | N-[2-(1,3-dioxan-2-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCC1OCCCO1)c1cccs1 |
| InChI | InChI=1S/C10H15NO4S2/c12-17(13,10-3-1-8-16-10)11-5-4-9-14-6-2-7-15-9/h1,3,8-9,11H,2,4-7H2 |
| InChIKey | TVNAGSZMQGYQGG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |