C11H17NO4S2 — CID 110369851
N-[2-(2-methyl-1,3-dioxan-2-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110369851) has the molecular formula C11H17NO4S2 and a molecular weight of 291.39 g/mol. Its IUPAC name is N-[2-(2-methyl-1,3-dioxan-2-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(2-methyl-1,3-dioxan-2-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110369851 |
| Molecular Formula | C11H17NO4S2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | N-[2-(2-methyl-1,3-dioxan-2-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CC1(CCNS(=O)(=O)c2cccs2)OCCCO1 |
| InChI | InChI=1S/C11H17NO4S2/c1-11(15-7-3-8-16-11)5-6-12-18(13,14)10-4-2-9-17-10/h2,4,9,12H,3,5-8H2,1H3 |
| InChIKey | LJXYXRKRCRISFJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |