C11H21IN6 — CID 119147427
1-cyclopropyl-2-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]guanidine;hydroiodide (PubChem CID 119147427) has the molecular formula C11H21IN6 and a molecular weight of 364.24 g/mol. Its IUPAC name is 1-cyclopropyl-2-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopropyl-2-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119147427 |
| Molecular Formula | C11H21IN6 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | 1-cyclopropyl-2-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]guanidine;hydroiodide |
| SMILES | CN(C)c1ncc(C/N=C(\N)NC2CC2)n1C.I |
| InChI | InChI=1S/C11H20N6.HI/c1-16(2)11-14-7-9(17(11)3)6-13-10(12)15-8-4-5-8;/h7-8H,4-6H2,1-3H3,(H3,12,13,15);1H |
| InChIKey | VSMGVERGVOYXBX-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|