C16H25IN6 — CID 119147413
2-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide (PubChem CID 119147413) has the molecular formula C16H25IN6 and a molecular weight of 428.32 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119147413 |
| Molecular Formula | C16H25IN6 |
| Molecular Weight | 428.32 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-[[2-(dimethylamino)-3-methylimidazol-4-yl]methyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/Cc2cnc(N(C)C)n2C)c1.I |
| InChI | InChI=1S/C16H24N6.HI/c1-11-6-12(2)8-13(7-11)20-15(17)18-9-14-10-19-16(21(3)4)22(14)5;/h6-8,10H,9H2,1-5H3,(H3,17,18,20);1H |
| InChIKey | BNEBLUZNDSXWPP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.32 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|