C16H19ClIN3 — CID 111022755
2-[(4-chlorophenyl)methyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide (PubChem CID 111022755) has the molecular formula C16H19ClIN3 and a molecular weight of 415.71 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111022755 |
| Molecular Formula | C16H19ClIN3 |
| Molecular Weight | 415.71 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-(3,5-dimethylphenyl)guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/Cc2ccc(Cl)cc2)c1.I |
| InChI | InChI=1S/C16H18ClN3.HI/c1-11-7-12(2)9-15(8-11)20-16(18)19-10-13-3-5-14(17)6-4-13;/h3-9H,10H2,1-2H3,(H3,18,19,20);1H |
| InChIKey | FYZFXLOWWJPXTO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.71 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|