C19H23N3 — CID 111071214
2-(2,3-dihydro-1H-inden-5-ylmethyl)-1-(3,5-dimethylphenyl)guanidine (PubChem CID 111071214) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-ylmethyl)-1-(3,5-dimethylphenyl)guanidine.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-ylmethyl)-1-(3,5-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 111071214 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-ylmethyl)-1-(3,5-dimethylphenyl)guanidine |
| SMILES | Cc1cc(C)cc(N/C(N)=N/Cc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C19H23N3/c1-13-8-14(2)10-18(9-13)22-19(20)21-12-15-6-7-16-4-3-5-17(16)11-15/h6-11H,3-5,12H2,1-2H3,(H3,20,21,22) |
| InChIKey | PBGDIQNAYGPQDZ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|