C12H21N5 — CID 103677225
1-cyclopentyl-2-[2-(4-methylpyrazol-1-yl)ethyl]guanidine (PubChem CID 103677225) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 1-cyclopentyl-2-[2-(4-methylpyrazol-1-yl)ethyl]guanidine.
| Compound Name | 1-cyclopentyl-2-[2-(4-methylpyrazol-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 103677225 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 1-cyclopentyl-2-[2-(4-methylpyrazol-1-yl)ethyl]guanidine |
| SMILES | Cc1cnn(CC/N=C(\N)NC2CCCC2)c1 |
| InChI | InChI=1S/C12H21N5/c1-10-8-15-17(9-10)7-6-14-12(13)16-11-4-2-3-5-11/h8-9,11H,2-7H2,1H3,(H3,13,14,16) |
| InChIKey | DZNOZSJZPKGYSM-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|