C11H19BrIN5 — CID 120973646
2-[2-(4-bromopyrazol-1-yl)ethyl]-1-cyclopentylguanidine;hydroiodide (PubChem CID 120973646) has the molecular formula C11H19BrIN5 and a molecular weight of 428.12 g/mol. Its IUPAC name is 2-[2-(4-bromopyrazol-1-yl)ethyl]-1-cyclopentylguanidine;hydroiodide.
| Compound Name | 2-[2-(4-bromopyrazol-1-yl)ethyl]-1-cyclopentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 120973646 |
| Molecular Formula | C11H19BrIN5 |
| Molecular Weight | 428.12 g/mol |
| Exact Mass | 426.99 |
| IUPAC Name | 2-[2-(4-bromopyrazol-1-yl)ethyl]-1-cyclopentylguanidine;hydroiodide |
| SMILES | I.N/C(=N\CCn1cc(Br)cn1)NC1CCCC1 |
| InChI | InChI=1S/C11H18BrN5.HI/c12-9-7-15-17(8-9)6-5-14-11(13)16-10-3-1-2-4-10;/h7-8,10H,1-6H2,(H3,13,14,16);1H |
| InChIKey | KHLLNUSZIAIPMW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.12 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|