C13H21F3IN5 — CID 119116693
1-cyclopentyl-2-methyl-3-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 119116693) has the molecular formula C13H21F3IN5 and a molecular weight of 431.24 g/mol. Its IUPAC name is 1-cyclopentyl-2-methyl-3-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-cyclopentyl-2-methyl-3-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 119116693 |
| Molecular Formula | C13H21F3IN5 |
| Molecular Weight | 431.24 g/mol |
| Exact Mass | 431.08 |
| IUPAC Name | 1-cyclopentyl-2-methyl-3-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nccn1CC(F)(F)F)NC1CCCC1.I |
| InChI | InChI=1S/C13H20F3N5.HI/c1-17-12(20-10-4-2-3-5-10)19-8-11-18-6-7-21(11)9-13(14,15)16;/h6-7,10H,2-5,8-9H2,1H3,(H2,17,19,20);1H |
| InChIKey | PILNJMBJPIJAMD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.24 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|