C17H27F3N6 — CID 119142967
N'-methyl-3-piperidin-1-yl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidine-1-carboximidamide (PubChem CID 119142967) has the molecular formula C17H27F3N6 and a molecular weight of 372.44 g/mol. Its IUPAC name is N'-methyl-3-piperidin-1-yl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-methyl-3-piperidin-1-yl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 119142967 |
| Molecular Formula | C17H27F3N6 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | N'-methyl-3-piperidin-1-yl-N-[[1-(2,2,2-trifluoroethyl)imidazol-2-yl]methyl]pyrrolidine-1-carboximidamide |
| SMILES | C/N=C(\NCc1nccn1CC(F)(F)F)N1CCC(N2CCCCC2)C1 |
| InChI | InChI=1S/C17H27F3N6/c1-21-16(23-11-15-22-6-10-26(15)13-17(18,19)20)25-9-5-14(12-25)24-7-3-2-4-8-24/h6,10,14H,2-5,7-9,11-13H2,1H3,(H,21,23) |
| InChIKey | OSBSPYVWWRXPIW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 48.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|