C6H10N4O2 — CID 62483333
1-hydroxy-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 62483333) has the molecular formula C6H10N4O2 and a molecular weight of 170.17 g/mol. Its IUPAC name is 1-hydroxy-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-hydroxy-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 62483333 |
| Molecular Formula | C6H10N4O2 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1-hydroxy-2-[(3-methyl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | Cc1cc(C/N=C(\N)NO)on1 |
| InChI | InChI=1S/C6H10N4O2/c1-4-2-5(12-10-4)3-8-6(7)9-11/h2,11H,3H2,1H3,(H3,7,8,9) |
| InChIKey | YBTHEXSWRTZMBK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 96.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|