C7H11N3OS — CID 130736483
1-hydroxy-2-[(4-methylthiophen-2-yl)methyl]guanidine (PubChem CID 130736483) has the molecular formula C7H11N3OS and a molecular weight of 185.25 g/mol. Its IUPAC name is 1-hydroxy-2-[(4-methylthiophen-2-yl)methyl]guanidine.
| Compound Name | 1-hydroxy-2-[(4-methylthiophen-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 130736483 |
| Molecular Formula | C7H11N3OS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.06 |
| IUPAC Name | 1-hydroxy-2-[(4-methylthiophen-2-yl)methyl]guanidine |
| SMILES | Cc1csc(C/N=C(\N)NO)c1 |
| InChI | InChI=1S/C7H11N3OS/c1-5-2-6(12-4-5)3-9-7(8)10-11/h2,4,11H,3H2,1H3,(H3,8,9,10) |
| InChIKey | CDIYUMXBFMRKTG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|