C14H16BrN3S — CID 111068721
2-[(4-bromothiophen-2-yl)methyl]-1-(3,4-dimethylphenyl)guanidine (PubChem CID 111068721) has the molecular formula C14H16BrN3S and a molecular weight of 338.27 g/mol. Its IUPAC name is 2-[(4-bromothiophen-2-yl)methyl]-1-(3,4-dimethylphenyl)guanidine.
| Compound Name | 2-[(4-bromothiophen-2-yl)methyl]-1-(3,4-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 111068721 |
| Molecular Formula | C14H16BrN3S |
| Molecular Weight | 338.27 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | 2-[(4-bromothiophen-2-yl)methyl]-1-(3,4-dimethylphenyl)guanidine |
| SMILES | Cc1ccc(N/C(N)=N/Cc2cc(Br)cs2)cc1C |
| InChI | InChI=1S/C14H16BrN3S/c1-9-3-4-12(5-10(9)2)18-14(16)17-7-13-6-11(15)8-19-13/h3-6,8H,7H2,1-2H3,(H3,16,17,18) |
| InChIKey | PVDIQIXSWPLFJY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|