C8H10BrN3O — CID 62481269
2-[(4-bromophenyl)methyl]-1-hydroxyguanidine (PubChem CID 62481269) has the molecular formula C8H10BrN3O and a molecular weight of 244.09 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1-hydroxyguanidine.
| Compound Name | 2-[(4-bromophenyl)methyl]-1-hydroxyguanidine |
|---|---|
| PubChem CID | 62481269 |
| Molecular Formula | C8H10BrN3O |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1-hydroxyguanidine |
| SMILES | N/C(=N\Cc1ccc(Br)cc1)NO |
| InChI | InChI=1S/C8H10BrN3O/c9-7-3-1-6(2-4-7)5-11-8(10)12-13/h1-4,13H,5H2,(H3,10,11,12) |
| InChIKey | MFKKNHGAGNTYND-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|