C15H14BrCl2N5 — CID 15233170
(1E)-1-[amino-(4-bromoanilino)methylidene]-2-[(3,4-dichlorophenyl)methyl]guanidine (PubChem CID 15233170) has the molecular formula C15H14BrCl2N5 and a molecular weight of 415.12 g/mol. Its IUPAC name is (1E)-1-[amino-(4-bromoanilino)methylidene]-2-[(3,4-dichlorophenyl)methyl]guanidine.
| Compound Name | (1E)-1-[amino-(4-bromoanilino)methylidene]-2-[(3,4-dichlorophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 15233170 |
| Molecular Formula | C15H14BrCl2N5 |
| Molecular Weight | 415.12 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | (1E)-1-[amino-(4-bromoanilino)methylidene]-2-[(3,4-dichlorophenyl)methyl]guanidine |
| SMILES | NC(=N\Cc1ccc(Cl)c(Cl)c1)/N=C(\N)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C15H14BrCl2N5/c16-10-2-4-11(5-3-10)22-15(20)23-14(19)21-8-9-1-6-12(17)13(18)7-9/h1-7H,8H2,(H5,19,20,21,22,23) |
| InChIKey | XPUWFEIEROXXOR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.12 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|