C16H16Cl3N5O2 — CID 158835764
1-[amino-(1,3-benzodioxol-5-ylamino)methylidene]-2-[(3,4-dichlorophenyl)methyl]guanidine;hydrochloride (PubChem CID 158835764) has the molecular formula C16H16Cl3N5O2 and a molecular weight of 416.70 g/mol. Its IUPAC name is 1-[amino-(1,3-benzodioxol-5-ylamino)methylidene]-2-[(3,4-dichlorophenyl)methyl]guanidine;hydrochloride.
| Compound Name | 1-[amino-(1,3-benzodioxol-5-ylamino)methylidene]-2-[(3,4-dichlorophenyl)methyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 158835764 |
| Molecular Formula | C16H16Cl3N5O2 |
| Molecular Weight | 416.70 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 1-[amino-(1,3-benzodioxol-5-ylamino)methylidene]-2-[(3,4-dichlorophenyl)methyl]guanidine;hydrochloride |
| SMILES | Cl.NC(=N/C(N)=N/Cc1ccc(Cl)c(Cl)c1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H15Cl2N5O2.ClH/c17-11-3-1-9(5-12(11)18)7-21-15(19)23-16(20)22-10-2-4-13-14(6-10)25-8-24-13;/h1-6H,7-8H2,(H5,19,20,21,22,23);1H |
| InChIKey | IXPPOCKCTMBXCJ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.70 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|