C9H11N3O2 — CID 62379596
1-(1,3-benzodioxol-5-yl)-2-methylguanidine (PubChem CID 62379596) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-2-methylguanidine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 62379596 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-2-methylguanidine |
| SMILES | C/N=C(\N)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C9H11N3O2/c1-11-9(10)12-6-2-3-7-8(4-6)14-5-13-7/h2-4H,5H2,1H3,(H3,10,11,12) |
| InChIKey | YDZSCSXKZPKRIJ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|