C10H12N2O3 — CID 22690584
(2S)-2-amino-N-(1,3-benzodioxol-5-yl)propanamide (PubChem CID 22690584) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is (2S)-2-amino-N-(1,3-benzodioxol-5-yl)propanamide.
| Compound Name | (2S)-2-amino-N-(1,3-benzodioxol-5-yl)propanamide |
|---|---|
| PubChem CID | 22690584 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | (2S)-2-amino-N-(1,3-benzodioxol-5-yl)propanamide |
| SMILES | C[C@H](N)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H12N2O3/c1-6(11)10(13)12-7-2-3-8-9(4-7)15-5-14-8/h2-4,6H,5,11H2,1H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | IBPBHJCVXUJDFI-LURJTMIESA-N |
| XLogP | 0.70 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |