C12H16N2O3 — CID 43700348
2-amino-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanamide (PubChem CID 43700348) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 2-amino-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanamide.
| Compound Name | 2-amino-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanamide |
|---|---|
| PubChem CID | 43700348 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-amino-N-(2,2-dimethyl-1,3-benzodioxol-5-yl)propanamide |
| SMILES | CC(N)C(=O)Nc1ccc2c(c1)OC(C)(C)O2 |
| InChI | InChI=1S/C12H16N2O3/c1-7(13)11(15)14-8-4-5-9-10(6-8)17-12(2,3)16-9/h4-7H,13H2,1-3H3,(H,14,15) |
| InChIKey | YHJUFRXTGQJBPL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |